About (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide
(2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide (PubChem CID 95380556) has the molecular formula C20H17N5O3
and a molecular weight of 375.39 g/mol. Its IUPAC name is (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide.
Molecular Properties
| Compound Name | (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide |
| PubChem CID | 95380556 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N([C@H](C)C(=O)Nc1ccn(-c3ccncc3)n1)C2=O |
| InChI | InChI=1S/C20H17N5O3/c1-12-3-4-15-16(11-12)20(28)25(19(15)27)13(2)18(26)22-17-7-10-24(23-17)14-5-8-21-9-6-14/h3-11,13H,1-2H3,(H,22,23,26)/t13-/m1/s1 |
| InChIKey | YWRNPJRTKDFIAM-CYBMUJFWSA-N |
| XLogP | 2.20 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide?
The IUPAC name of (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide (CID 95380556) is (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide.
What is the SMILES notation for (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide?
The canonical SMILES for (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide is Cc1ccc2c(c1)C(=O)N([C@H](C)C(=O)Nc1ccn(-c3ccncc3)n1)C2=O.
What is the InChIKey of (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide?
The InChIKey is YWRNPJRTKDFIAM-CYBMUJFWSA-N. The full InChI is InChI=1S/C20H17N5O3/c1-12-3-4-15-16(11-12)20(28)25(19(15)27)13(2)18(26)22-17-7-10-24(23-17)14-5-8-21-9-6-14/h3-11,13H,1-2H3,(H,22,23,26)/t13-/m1/s1.
What are the key properties of (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide?
(2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide has a molecular weight of 375.39 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(5-methyl-1,3-dioxoisoindol-2-yl)-N-(1-pyridin-4-ylpyrazol-3-yl)propanamide is sourced from PubChem (CID 95380556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).