C19H22N4O3 — CID 95384675
5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]furan-2-carboxamide (PubChem CID 95384675) has the molecular formula C19H22N4O3 and a molecular weight of 354.41 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]furan-2-carboxamide.
| Compound Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95384675 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 5-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-N-[(4R)-1-methyl-4,5,6,7-tetrahydroindazol-4-yl]furan-2-carboxamide |
| SMILES | Cc1noc(C)c1Cc1ccc(C(=O)N[C@@H]2CCCc3c2cnn3C)o1 |
| InChI | InChI=1S/C19H22N4O3/c1-11-14(12(2)26-22-11)9-13-7-8-18(25-13)19(24)21-16-5-4-6-17-15(16)10-20-23(17)3/h7-8,10,16H,4-6,9H2,1-3H3,(H,21,24)/t16-/m1/s1 |
| InChIKey | AGCQZHDFNJZSKB-MRXNPFEDSA-N |
| XLogP | 3.02 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |