C21H27N3O5 — CID 95389236
(4R)-1-cycloheptyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione (PubChem CID 95389236) has the molecular formula C21H27N3O5 and a molecular weight of 401.46 g/mol. Its IUPAC name is (4R)-1-cycloheptyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione.
| Compound Name | (4R)-1-cycloheptyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
|---|---|
| PubChem CID | 95389236 |
| Molecular Formula | C21H27N3O5 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (4R)-1-cycloheptyl-4-(4-hydroxy-3,5-dimethoxyphenyl)-2,4,5,7-tetrahydropyrazolo[3,4-b]pyridine-3,6-dione |
| SMILES | COc1cc([C@H]2CC(=O)Nc3c2c(=O)[nH]n3C2CCCCCC2)cc(OC)c1O |
| InChI | InChI=1S/C21H27N3O5/c1-28-15-9-12(10-16(29-2)19(15)26)14-11-17(25)22-20-18(14)21(27)23-24(20)13-7-5-3-4-6-8-13/h9-10,13-14,26H,3-8,11H2,1-2H3,(H,22,25)(H,23,27)/t14-/m1/s1 |
| InChIKey | AKCKRVHGOGQYBF-CQSZACIVSA-N |
| XLogP | 3.27 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |