C16H19N3O3S3 — CID 95390067
(5R)-5-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-1,5-dihydrothieno[3,2-e][1,4]thiazepin-2-one (PubChem CID 95390067) has the molecular formula C16H19N3O3S3 and a molecular weight of 397.55 g/mol. Its IUPAC name is (5R)-5-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-1,5-dihydrothieno[3,2-e][1,4]thiazepin-2-one.
| Compound Name | (5R)-5-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-1,5-dihydrothieno[3,2-e][1,4]thiazepin-2-one |
|---|---|
| PubChem CID | 95390067 |
| Molecular Formula | C16H19N3O3S3 |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.06 |
| IUPAC Name | (5R)-5-[1-[(3R)-1,1-dioxothiolan-3-yl]-3,5-dimethylpyrazol-4-yl]-1,5-dihydrothieno[3,2-e][1,4]thiazepin-2-one |
| SMILES | Cc1nn([C@@H]2CCS(=O)(=O)C2)c(C)c1[C@H]1SCC(=O)Nc2ccsc21 |
| InChI | InChI=1S/C16H19N3O3S3/c1-9-14(10(2)19(18-9)11-4-6-25(21,22)8-11)16-15-12(3-5-23-15)17-13(20)7-24-16/h3,5,11,16H,4,6-8H2,1-2H3,(H,17,20)/t11-,16-/m1/s1 |
| InChIKey | KESBASQNYMOTQS-BDJLRTHQSA-N |
| XLogP | 2.70 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |