About [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol
[(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol (PubChem CID 95394299) has the molecular formula C21H21F2N3O
and a molecular weight of 369.42 g/mol. Its IUPAC name is [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol |
| PubChem CID | 95394299 |
| Molecular Formula | C21H21F2N3O |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol |
| SMILES | OC[C@]1(Cc2ccc(F)cc2F)CCCN(c2cnc3ccccc3n2)C1 |
| InChI | InChI=1S/C21H21F2N3O/c22-16-7-6-15(17(23)10-16)11-21(14-27)8-3-9-26(13-21)20-12-24-18-4-1-2-5-19(18)25-20/h1-2,4-7,10,12,27H,3,8-9,11,13-14H2/t21-/m0/s1 |
| InChIKey | YTEGNKLMVIYJNE-NRFANRHFSA-N |
| XLogP | 3.73 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol?
The IUPAC name of [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol (CID 95394299) is [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol.
What is the SMILES notation for [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol?
The canonical SMILES for [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol is OC[C@]1(Cc2ccc(F)cc2F)CCCN(c2cnc3ccccc3n2)C1.
What is the InChIKey of [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol?
The InChIKey is YTEGNKLMVIYJNE-NRFANRHFSA-N. The full InChI is InChI=1S/C21H21F2N3O/c22-16-7-6-15(17(23)10-16)11-21(14-27)8-3-9-26(13-21)20-12-24-18-4-1-2-5-19(18)25-20/h1-2,4-7,10,12,27H,3,8-9,11,13-14H2/t21-/m0/s1.
What are the key properties of [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol?
[(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol has a molecular weight of 369.42 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-[(2,4-difluorophenyl)methyl]-1-quinoxalin-2-ylpiperidin-3-yl]methanol is sourced from PubChem (CID 95394299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).