About (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide
(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide (PubChem CID 95396449) has the molecular formula C10H19NO2S
and a molecular weight of 217.33 g/mol. Its IUPAC name is (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide.
Molecular Properties
| Compound Name | (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide |
| PubChem CID | 95396449 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide |
| SMILES | CC[C@@](C)(CCC(N)=S)C1OCCO1 |
| InChI | InChI=1S/C10H19NO2S/c1-3-10(2,5-4-8(11)14)9-12-6-7-13-9/h9H,3-7H2,1-2H3,(H2,11,14)/t10-/m0/s1 |
| InChIKey | SCQVBXJRKFWHIU-JTQLQIEISA-N |
| XLogP | 1.84 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide?
The IUPAC name of (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide (CID 95396449) is (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide.
What is the SMILES notation for (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide?
The canonical SMILES for (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide is CC[C@@](C)(CCC(N)=S)C1OCCO1.
What is the InChIKey of (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide?
The InChIKey is SCQVBXJRKFWHIU-JTQLQIEISA-N. The full InChI is InChI=1S/C10H19NO2S/c1-3-10(2,5-4-8(11)14)9-12-6-7-13-9/h9H,3-7H2,1-2H3,(H2,11,14)/t10-/m0/s1.
What are the key properties of (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide?
(4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide has a molecular weight of 217.33 g/mol, XLogP of 1.84, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-(1,3-dioxolan-2-yl)-4-methylhexanethioamide is sourced from PubChem (CID 95396449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).