About 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid
2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid (PubChem CID 95396546) has the molecular formula C5H8F3NO3
and a molecular weight of 187.12 g/mol. Its IUPAC name is 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid.
Molecular Properties
| Compound Name | 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid |
| PubChem CID | 95396546 |
| Molecular Formula | C5H8F3NO3 |
| Molecular Weight | 187.12 g/mol |
| Exact Mass | 187.05 |
| IUPAC Name | 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid |
| SMILES | NC[C@H](OCC(=O)O)C(F)(F)F |
| InChI | InChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11)/t3-/m0/s1 |
| InChIKey | CORHSPNAMKSFPB-VKHMYHEASA-N |
| XLogP | -0.02 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.12 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid?
The IUPAC name of 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid (CID 95396546) is 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid.
What is the SMILES notation for 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid?
The canonical SMILES for 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid is NC[C@H](OCC(=O)O)C(F)(F)F.
What is the InChIKey of 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid?
The InChIKey is CORHSPNAMKSFPB-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8F3NO3/c6-5(7,8)3(1-9)12-2-4(10)11/h3H,1-2,9H2,(H,10,11)/t3-/m0/s1.
What are the key properties of 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid?
2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid has a molecular weight of 187.12 g/mol, XLogP of -0.02, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-3-amino-1,1,1-trifluoropropan-2-yl]oxyacetic acid is sourced from PubChem (CID 95396546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).