C19H22N2O2 — CID 95399045
(3S)-3-[2-[(1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one (PubChem CID 95399045) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (3S)-3-[2-[(1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one.
| Compound Name | (3S)-3-[2-[(1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 95399045 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (3S)-3-[2-[(1R,2R,6S,7S)-4-azatricyclo[5.2.1.02,6]decan-4-yl]-2-oxoethyl]-2,3-dihydroisoindol-1-one |
| SMILES | O=C1N[C@@H](CC(=O)N2C[C@@H]3[C@@H]4CC[C@@H](C4)[C@@H]3C2)c2ccccc21 |
| InChI | InChI=1S/C19H22N2O2/c22-18(8-17-13-3-1-2-4-14(13)19(23)20-17)21-9-15-11-5-6-12(7-11)16(15)10-21/h1-4,11-12,15-17H,5-10H2,(H,20,23)/t11-,12+,15-,16+,17-/m0/s1 |
| InChIKey | ZCAZMWAFFRFCMG-GMKCAIKYSA-N |
| XLogP | 2.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |