C30H28F3N3O6 — CID 95399511
propyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 95399511) has the molecular formula C30H28F3N3O6 and a molecular weight of 583.56 g/mol. Its IUPAC name is propyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | propyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 95399511 |
| Molecular Formula | C30H28F3N3O6 |
| Molecular Weight | 583.56 g/mol |
| Exact Mass | 583.19 |
| IUPAC Name | propyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | CCCOC(=O)c1ccc(Oc2c(C(F)(F)F)oc3c(CN4CCN(c5ccccn5)CC4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C30H28F3N3O6/c1-2-17-40-29(39)19-6-8-20(9-7-19)41-27-25(38)21-10-11-23(37)22(26(21)42-28(27)30(31,32)33)18-35-13-15-36(16-14-35)24-5-3-4-12-34-24/h3-12,37H,2,13-18H2,1H3 |
| InChIKey | IECFYRJMGAMHME-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|