C28H24F3N3O6 — CID 95399512
methyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate (PubChem CID 95399512) has the molecular formula C28H24F3N3O6 and a molecular weight of 555.51 g/mol. Its IUPAC name is methyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate.
| Compound Name | methyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
|---|---|
| PubChem CID | 95399512 |
| Molecular Formula | C28H24F3N3O6 |
| Molecular Weight | 555.51 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | methyl 4-[7-hydroxy-4-oxo-8-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-2-(trifluoromethyl)chromen-3-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2c(C(F)(F)F)oc3c(CN4CCN(c5ccccn5)CC4)c(O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C28H24F3N3O6/c1-38-27(37)17-5-7-18(8-6-17)39-25-23(36)19-9-10-21(35)20(24(19)40-26(25)28(29,30)31)16-33-12-14-34(15-13-33)22-4-2-3-11-32-22/h2-11,35H,12-16H2,1H3 |
| InChIKey | MUWGLSPPMWBIGR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.51 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|