C28H19Cl2NO5 — CID 95399845
4-(6-chloro-2-oxochromen-3-yl)-9-[2-(2-chlorophenyl)ethyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one (PubChem CID 95399845) has the molecular formula C28H19Cl2NO5 and a molecular weight of 520.37 g/mol. Its IUPAC name is 4-(6-chloro-2-oxochromen-3-yl)-9-[2-(2-chlorophenyl)ethyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one.
| Compound Name | 4-(6-chloro-2-oxochromen-3-yl)-9-[2-(2-chlorophenyl)ethyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
|---|---|
| PubChem CID | 95399845 |
| Molecular Formula | C28H19Cl2NO5 |
| Molecular Weight | 520.37 g/mol |
| Exact Mass | 519.06 |
| IUPAC Name | 4-(6-chloro-2-oxochromen-3-yl)-9-[2-(2-chlorophenyl)ethyl]-8,10-dihydropyrano[2,3-f][1,3]benzoxazin-2-one |
| SMILES | O=c1cc(-c2cc3cc(Cl)ccc3oc2=O)c2ccc3c(c2o1)CN(CCc1ccccc1Cl)CO3 |
| InChI | InChI=1S/C28H19Cl2NO5/c29-18-5-7-24-17(11-18)12-21(28(33)35-24)20-13-26(32)36-27-19(20)6-8-25-22(27)14-31(15-34-25)10-9-16-3-1-2-4-23(16)30/h1-8,11-13H,9-10,14-15H2 |
| InChIKey | WCHGICDTUAVZDP-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 72.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.37 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|