C12H16N4O3 — CID 95400189
1-(3-nitrophenyl)-3-[(3R)-piperidin-3-yl]urea (PubChem CID 95400189) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(3-nitrophenyl)-3-[(3R)-piperidin-3-yl]urea.
| Compound Name | 1-(3-nitrophenyl)-3-[(3R)-piperidin-3-yl]urea |
|---|---|
| PubChem CID | 95400189 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(3-nitrophenyl)-3-[(3R)-piperidin-3-yl]urea |
| SMILES | O=C(Nc1cccc([N+](=O)[O-])c1)N[C@@H]1CCCNC1 |
| InChI | InChI=1S/C12H16N4O3/c17-12(15-10-4-2-6-13-8-10)14-9-3-1-5-11(7-9)16(18)19/h1,3,5,7,10,13H,2,4,6,8H2,(H2,14,15,17)/t10-/m1/s1 |
| InChIKey | HRAMMGVYHWYGSH-SNVBAGLBSA-N |
| XLogP | 1.47 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|