C18H19N5S — CID 95401019
2-[(5R)-3,5-diphenyltetrazolidin-2-yl]-4,5-dimethyl-1,3-thiazole (PubChem CID 95401019) has the molecular formula C18H19N5S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[(5R)-3,5-diphenyltetrazolidin-2-yl]-4,5-dimethyl-1,3-thiazole.
| Compound Name | 2-[(5R)-3,5-diphenyltetrazolidin-2-yl]-4,5-dimethyl-1,3-thiazole |
|---|---|
| PubChem CID | 95401019 |
| Molecular Formula | C18H19N5S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 2-[(5R)-3,5-diphenyltetrazolidin-2-yl]-4,5-dimethyl-1,3-thiazole |
| SMILES | Cc1nc(N2N[C@H](c3ccccc3)NN2c2ccccc2)sc1C |
| InChI | InChI=1S/C18H19N5S/c1-13-14(2)24-18(19-13)23-21-17(15-9-5-3-6-10-15)20-22(23)16-11-7-4-8-12-16/h3-12,17,20-21H,1-2H3/t17-/m1/s1 |
| InChIKey | QFPZMJPLWKOVEY-QGZVFWFLSA-N |
| XLogP | 3.71 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |