C21H18ClNO3 — CID 95402297
(2R)-2-(4-chlorophenyl)-4-hydroxy-3-(4-methylphenyl)-1-prop-2-enyl-2H-pyridine-5,6-dione (PubChem CID 95402297) has the molecular formula C21H18ClNO3 and a molecular weight of 367.83 g/mol. Its IUPAC name is (2R)-2-(4-chlorophenyl)-4-hydroxy-3-(4-methylphenyl)-1-prop-2-enyl-2H-pyridine-5,6-dione.
| Compound Name | (2R)-2-(4-chlorophenyl)-4-hydroxy-3-(4-methylphenyl)-1-prop-2-enyl-2H-pyridine-5,6-dione |
|---|---|
| PubChem CID | 95402297 |
| Molecular Formula | C21H18ClNO3 |
| Molecular Weight | 367.83 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | (2R)-2-(4-chlorophenyl)-4-hydroxy-3-(4-methylphenyl)-1-prop-2-enyl-2H-pyridine-5,6-dione |
| SMILES | C=CCN1C(=O)C(=O)C(O)=C(c2ccc(C)cc2)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18ClNO3/c1-3-12-23-18(15-8-10-16(22)11-9-15)17(19(24)20(25)21(23)26)14-6-4-13(2)5-7-14/h3-11,18,24H,1,12H2,2H3/t18-/m1/s1 |
| InChIKey | IDLCLISGZGFXCV-GOSISDBHSA-N |
| XLogP | 4.26 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.83 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|