C21H27N5O — CID 95402728
(3R)-1-[2-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrimidin-4-yl]pyrrolidin-3-ol (PubChem CID 95402728) has the molecular formula C21H27N5O and a molecular weight of 365.48 g/mol. Its IUPAC name is (3R)-1-[2-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrimidin-4-yl]pyrrolidin-3-ol.
| Compound Name | (3R)-1-[2-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrimidin-4-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 95402728 |
| Molecular Formula | C21H27N5O |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.22 |
| IUPAC Name | (3R)-1-[2-[(2-ethyl-3,5-dimethyl-1H-indol-7-yl)methylamino]pyrimidin-4-yl]pyrrolidin-3-ol |
| SMILES | CCc1[nH]c2c(CNc3nccc(N4CC[C@@H](O)C4)n3)cc(C)cc2c1C |
| InChI | InChI=1S/C21H27N5O/c1-4-18-14(3)17-10-13(2)9-15(20(17)24-18)11-23-21-22-7-5-19(25-21)26-8-6-16(27)12-26/h5,7,9-10,16,24,27H,4,6,8,11-12H2,1-3H3,(H,22,23,25)/t16-/m1/s1 |
| InChIKey | OGVXJQDPMFOISQ-MRXNPFEDSA-N |
| XLogP | 3.32 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|