C19H22FN3O2 — CID 95403136
1-[2-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]pyrimidin-2-one (PubChem CID 95403136) has the molecular formula C19H22FN3O2 and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[2-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]pyrimidin-2-one.
| Compound Name | 1-[2-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]pyrimidin-2-one |
|---|---|
| PubChem CID | 95403136 |
| Molecular Formula | C19H22FN3O2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 1-[2-[(3S)-3-[2-(4-fluorophenyl)ethyl]piperidin-1-yl]-2-oxoethyl]pyrimidin-2-one |
| SMILES | O=C(Cn1cccnc1=O)N1CCC[C@H](CCc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C19H22FN3O2/c20-17-8-6-15(7-9-17)4-5-16-3-1-11-22(13-16)18(24)14-23-12-2-10-21-19(23)25/h2,6-10,12,16H,1,3-5,11,13-14H2/t16-/m1/s1 |
| InChIKey | RKBKMDQFMGSLQL-MRXNPFEDSA-N |
| XLogP | 2.25 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |