About methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate
methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (PubChem CID 954117) has the molecular formula C15H11ClN4O3
and a molecular weight of 330.73 g/mol. Its IUPAC name is methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
Molecular Properties
| Compound Name | methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| PubChem CID | 954117 |
| Molecular Formula | C15H11ClN4O3 |
| Molecular Weight | 330.73 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(-c2ccc(C=Nn3cnnc3)o2)c1 |
| InChI | InChI=1S/C15H11ClN4O3/c1-22-15(21)10-2-4-13(16)12(6-10)14-5-3-11(23-14)7-19-20-8-17-18-9-20/h2-9H,1H3 |
| InChIKey | ULDXRAHPXRIPEC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 82.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The IUPAC name of methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate (CID 954117) is methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate.
What is the SMILES notation for methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The canonical SMILES for methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate is COC(=O)c1ccc(Cl)c(-c2ccc(C=Nn3cnnc3)o2)c1.
What is the InChIKey of methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
The InChIKey is ULDXRAHPXRIPEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClN4O3/c1-22-15(21)10-2-4-13(16)12(6-10)14-5-3-11(23-14)7-19-20-8-17-18-9-20/h2-9H,1H3.
What are the key properties of methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate?
methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate has a molecular weight of 330.73 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-chloro-3-[5-(1,2,4-triazol-4-yliminomethyl)furan-2-yl]benzoate is sourced from PubChem (CID 954117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).