C17H20FN3O3S — CID 95415991
2-[(4-fluorophenoxy)methyl]-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine (PubChem CID 95415991) has the molecular formula C17H20FN3O3S and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-[(4-fluorophenoxy)methyl]-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine.
| Compound Name | 2-[(4-fluorophenoxy)methyl]-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine |
|---|---|
| PubChem CID | 95415991 |
| Molecular Formula | C17H20FN3O3S |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-[(4-fluorophenoxy)methyl]-5-methylsulfonyl-4-[(3S)-piperidin-3-yl]pyrimidine |
| SMILES | CS(=O)(=O)c1cnc(COc2ccc(F)cc2)nc1[C@H]1CCCNC1 |
| InChI | InChI=1S/C17H20FN3O3S/c1-25(22,23)15-10-20-16(11-24-14-6-4-13(18)5-7-14)21-17(15)12-3-2-8-19-9-12/h4-7,10,12,19H,2-3,8-9,11H2,1H3/t12-/m0/s1 |
| InChIKey | QXJWCSITPPORMN-LBPRGKRZSA-N |
| XLogP | 2.07 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |