C11H13ClN2O — CID 95433072
(1R)-2-amino-1-(6-chloro-1-methylindol-3-yl)ethanol (PubChem CID 95433072) has the molecular formula C11H13ClN2O and a molecular weight of 224.69 g/mol. Its IUPAC name is (1R)-2-amino-1-(6-chloro-1-methylindol-3-yl)ethanol.
| Compound Name | (1R)-2-amino-1-(6-chloro-1-methylindol-3-yl)ethanol |
|---|---|
| PubChem CID | 95433072 |
| Molecular Formula | C11H13ClN2O |
| Molecular Weight | 224.69 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | (1R)-2-amino-1-(6-chloro-1-methylindol-3-yl)ethanol |
| SMILES | Cn1cc([C@@H](O)CN)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H13ClN2O/c1-14-6-9(11(15)5-13)8-3-2-7(12)4-10(8)14/h2-4,6,11,15H,5,13H2,1H3/t11-/m0/s1 |
| InChIKey | CHOQLOMPZVSCAJ-NSHDSACASA-N |
| XLogP | 1.82 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |