About 1-(3-propan-2-yloxypropyl)-1,4-diazepane
1-(3-propan-2-yloxypropyl)-1,4-diazepane (PubChem CID 95438255) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-(3-propan-2-yloxypropyl)-1,4-diazepane.
Molecular Properties
| Compound Name | 1-(3-propan-2-yloxypropyl)-1,4-diazepane |
| PubChem CID | 95438255 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-(3-propan-2-yloxypropyl)-1,4-diazepane |
| SMILES | CC(C)OCCCN1CCCNCC1 |
| InChI | InChI=1S/C11H24N2O/c1-11(2)14-10-4-8-13-7-3-5-12-6-9-13/h11-12H,3-10H2,1-2H3 |
| InChIKey | SKPQHXSDIMWZJN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-propan-2-yloxypropyl)-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-propan-2-yloxypropyl)-1,4-diazepane?
The IUPAC name of 1-(3-propan-2-yloxypropyl)-1,4-diazepane (CID 95438255) is 1-(3-propan-2-yloxypropyl)-1,4-diazepane.
What is the SMILES notation for 1-(3-propan-2-yloxypropyl)-1,4-diazepane?
The canonical SMILES for 1-(3-propan-2-yloxypropyl)-1,4-diazepane is CC(C)OCCCN1CCCNCC1.
What is the InChIKey of 1-(3-propan-2-yloxypropyl)-1,4-diazepane?
The InChIKey is SKPQHXSDIMWZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O/c1-11(2)14-10-4-8-13-7-3-5-12-6-9-13/h11-12H,3-10H2,1-2H3.
What are the key properties of 1-(3-propan-2-yloxypropyl)-1,4-diazepane?
1-(3-propan-2-yloxypropyl)-1,4-diazepane has a molecular weight of 200.33 g/mol, XLogP of 1.10, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-propan-2-yloxypropyl)-1,4-diazepane is sourced from PubChem (CID 95438255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).