C11H15NO3 — CID 95440369
(3R)-3-[4-(dimethylamino)phenyl]-3-hydroxypropanoic acid (PubChem CID 95440369) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (3R)-3-[4-(dimethylamino)phenyl]-3-hydroxypropanoic acid.
| Compound Name | (3R)-3-[4-(dimethylamino)phenyl]-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 95440369 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (3R)-3-[4-(dimethylamino)phenyl]-3-hydroxypropanoic acid |
| SMILES | CN(C)c1ccc([C@H](O)CC(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO3/c1-12(2)9-5-3-8(4-6-9)10(13)7-11(14)15/h3-6,10,13H,7H2,1-2H3,(H,14,15)/t10-/m1/s1 |
| InChIKey | JFVIWHDBVCXMQU-SNVBAGLBSA-N |
| XLogP | 1.26 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|