C14H21NO — CID 95443466
methyl 4-(2,4,5-trimethylphenyl)butanimidate (PubChem CID 95443466) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is methyl 4-(2,4,5-trimethylphenyl)butanimidate.
| Compound Name | methyl 4-(2,4,5-trimethylphenyl)butanimidate |
|---|---|
| PubChem CID | 95443466 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | methyl 4-(2,4,5-trimethylphenyl)butanimidate |
| SMILES | [H]/N=C(/CCCc1cc(C)c(C)cc1C)OC |
| InChI | InChI=1S/C14H21NO/c1-10-8-12(3)13(9-11(10)2)6-5-7-14(15)16-4/h8-9,15H,5-7H2,1-4H3/b15-14- |
| InChIKey | DHHBZJIYBOPXIT-PFONDFGASA-N |
| XLogP | 3.56 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|