C11H12F3N3O2 — CID 95463386
2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxamide (PubChem CID 95463386) has the molecular formula C11H12F3N3O2 and a molecular weight of 275.23 g/mol. Its IUPAC name is 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxamide.
| Compound Name | 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 95463386 |
| Molecular Formula | C11H12F3N3O2 |
| Molecular Weight | 275.23 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2-[(2R)-2-(trifluoromethyl)morpholin-4-yl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1N1CCO[C@@H](C(F)(F)F)C1 |
| InChI | InChI=1S/C11H12F3N3O2/c12-11(13,14)8-6-17(4-5-19-8)10-7(9(15)18)2-1-3-16-10/h1-3,8H,4-6H2,(H2,15,18)/t8-/m1/s1 |
| InChIKey | HEKFOOGVOSPFKS-MRVPVSSYSA-N |
| XLogP | 0.95 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.23 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |