About [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine
[2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine (PubChem CID 95474815) has the molecular formula C11H11Cl2N3O
and a molecular weight of 272.13 g/mol. Its IUPAC name is [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine |
| PubChem CID | 95474815 |
| Molecular Formula | C11H11Cl2N3O |
| Molecular Weight | 272.13 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine |
| SMILES | NCc1cnc(COc2cc(Cl)cc(Cl)c2)[nH]1 |
| InChI | InChI=1S/C11H11Cl2N3O/c12-7-1-8(13)3-10(2-7)17-6-11-15-5-9(4-14)16-11/h1-3,5H,4,6,14H2,(H,15,16) |
| InChIKey | HDAIIGLVNCBURO-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.13 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine?
The IUPAC name of [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine (CID 95474815) is [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine.
What is the SMILES notation for [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine?
The canonical SMILES for [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine is NCc1cnc(COc2cc(Cl)cc(Cl)c2)[nH]1.
What is the InChIKey of [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine?
The InChIKey is HDAIIGLVNCBURO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3O/c12-7-1-8(13)3-10(2-7)17-6-11-15-5-9(4-14)16-11/h1-3,5H,4,6,14H2,(H,15,16).
What are the key properties of [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine?
[2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine has a molecular weight of 272.13 g/mol, XLogP of 2.75, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(3,5-dichlorophenoxy)methyl]-1H-imidazol-5-yl]methanamine is sourced from PubChem (CID 95474815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).