C18H28N2 — CID 95475360
1-[1-(2,3-dimethylphenyl)cyclohexyl]piperazine (PubChem CID 95475360) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 1-[1-(2,3-dimethylphenyl)cyclohexyl]piperazine.
| Compound Name | 1-[1-(2,3-dimethylphenyl)cyclohexyl]piperazine |
|---|---|
| PubChem CID | 95475360 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 1-[1-(2,3-dimethylphenyl)cyclohexyl]piperazine |
| SMILES | Cc1cccc(C2(N3CCNCC3)CCCCC2)c1C |
| InChI | InChI=1S/C18H28N2/c1-15-7-6-8-17(16(15)2)18(9-4-3-5-10-18)20-13-11-19-12-14-20/h6-8,19H,3-5,9-14H2,1-2H3 |
| InChIKey | QDRMTUGBTIWFLN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |