C17H17N7OS — CID 95477034
(6S)-2,6-diamino-4-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 95477034) has the molecular formula C17H17N7OS and a molecular weight of 367.44 g/mol. Its IUPAC name is (6S)-2,6-diamino-4-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (6S)-2,6-diamino-4-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 95477034 |
| Molecular Formula | C17H17N7OS |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (6S)-2,6-diamino-4-[5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-yl]-5,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cn1cnnc1Sc1ccc(-c2c(C#N)c(N)nc3c2C[C@@H](N)CC3)o1 |
| InChI | InChI=1S/C17H17N7OS/c1-24-8-21-23-17(24)26-14-5-4-13(25-14)15-10-6-9(19)2-3-12(10)22-16(20)11(15)7-18/h4-5,8-9H,2-3,6,19H2,1H3,(H2,20,22)/t9-/m0/s1 |
| InChIKey | CDENKSMHSXBXBZ-VIFPVBQESA-N |
| XLogP | 1.89 |
| TPSA | 132.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |