About 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid
2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid (PubChem CID 95480900) has the molecular formula C14H15NO5
and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid |
| PubChem CID | 95480900 |
| Molecular Formula | C14H15NO5 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid |
| SMILES | COc1ccc(Cn2oc(=O)c(C)c2C(=O)O)cc1C |
| InChI | InChI=1S/C14H15NO5/c1-8-6-10(4-5-11(8)19-3)7-15-12(13(16)17)9(2)14(18)20-15/h4-6H,7H2,1-3H3,(H,16,17) |
| InChIKey | PKIQVVPEZLLWOZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid?
The IUPAC name of 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid (CID 95480900) is 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid is COc1ccc(Cn2oc(=O)c(C)c2C(=O)O)cc1C.
What is the InChIKey of 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid?
The InChIKey is PKIQVVPEZLLWOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO5/c1-8-6-10(4-5-11(8)19-3)7-15-12(13(16)17)9(2)14(18)20-15/h4-6H,7H2,1-3H3,(H,16,17).
What are the key properties of 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid?
2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid has a molecular weight of 277.28 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methoxy-3-methylphenyl)methyl]-4-methyl-5-oxo-1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 95480900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).