C21H34N4O2 — CID 95486412
(3R)-N-(3-methoxypropyl)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide (PubChem CID 95486412) has the molecular formula C21H34N4O2 and a molecular weight of 374.53 g/mol. Its IUPAC name is (3R)-N-(3-methoxypropyl)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3R)-N-(3-methoxypropyl)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 95486412 |
| Molecular Formula | C21H34N4O2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | (3R)-N-(3-methoxypropyl)-1-[1-(pyridin-4-ylmethyl)piperidin-4-yl]piperidine-3-carboxamide |
| SMILES | COCCCNC(=O)[C@@H]1CCCN(C2CCN(Cc3ccncc3)CC2)C1 |
| InChI | InChI=1S/C21H34N4O2/c1-27-15-3-9-23-21(26)19-4-2-12-25(17-19)20-7-13-24(14-8-20)16-18-5-10-22-11-6-18/h5-6,10-11,19-20H,2-4,7-9,12-17H2,1H3,(H,23,26)/t19-/m1/s1 |
| InChIKey | VQJUTSANVSYDDU-LJQANCHMSA-N |
| XLogP | 1.91 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|