C20H29NO3 — CID 95486491
1-[(3S)-3-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-4-methylpentane-1,2-dione (PubChem CID 95486491) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(3S)-3-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-4-methylpentane-1,2-dione.
| Compound Name | 1-[(3S)-3-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-4-methylpentane-1,2-dione |
|---|---|
| PubChem CID | 95486491 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | 1-[(3S)-3-[2-(4-methoxyphenyl)ethyl]piperidin-1-yl]-4-methylpentane-1,2-dione |
| SMILES | COc1ccc(CC[C@H]2CCCN(C(=O)C(=O)CC(C)C)C2)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-15(2)13-19(22)20(23)21-12-4-5-17(14-21)7-6-16-8-10-18(24-3)11-9-16/h8-11,15,17H,4-7,12-14H2,1-3H3/t17-/m1/s1 |
| InChIKey | AZUWUFUCVYMSGC-QGZVFWFLSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|