C23H30N2O2 — CID 95502535
(3R)-3-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]-1-(3-phenylpropyl)piperidin-2-one (PubChem CID 95502535) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]-1-(3-phenylpropyl)piperidin-2-one.
| Compound Name | (3R)-3-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]-1-(3-phenylpropyl)piperidin-2-one |
|---|---|
| PubChem CID | 95502535 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | (3R)-3-hydroxy-3-[[(2-methylphenyl)methylamino]methyl]-1-(3-phenylpropyl)piperidin-2-one |
| SMILES | Cc1ccccc1CNC[C@]1(O)CCCN(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C23H30N2O2/c1-19-9-5-6-13-21(19)17-24-18-23(27)14-8-16-25(22(23)26)15-7-12-20-10-3-2-4-11-20/h2-6,9-11,13,24,27H,7-8,12,14-18H2,1H3/t23-/m1/s1 |
| InChIKey | PRUVJDOMXKRRBI-HSZRJFAPSA-N |
| XLogP | 3.07 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |