C15H23N5O2 — CID 9550722
N-[3-(diethylamino)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide (PubChem CID 9550722) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
|---|---|
| PubChem CID | 9550722 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(1-oxopyrrolo[1,2-d][1,2,4]triazin-2-yl)acetamide |
| SMILES | CCN(CC)CCCNC(=O)CN1C(=O)C2=CC=CN2C=N1 |
| InChI | InChI=1S/C15H23N5O2/c1-3-18(4-2)9-6-8-16-14(21)11-20-15(22)13-7-5-10-19(13)12-17-20/h5,7,10,12H,3-4,6,8-9,11H2,1-2H3,(H,16,21) |
| InChIKey | AUABABGHDVXRNT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 69.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | 422 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|