About 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine
4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine (PubChem CID 95509786) has the molecular formula C19H28N6
and a molecular weight of 340.48 g/mol. Its IUPAC name is 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
| PubChem CID | 95509786 |
| Molecular Formula | C19H28N6 |
| Molecular Weight | 340.48 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2ccnc(NC[C@@H](C)N3CCN(C)CC3)n2)c(C)n1 |
| InChI | InChI=1S/C19H28N6/c1-14-5-6-17(16(3)22-14)18-7-8-20-19(23-18)21-13-15(2)25-11-9-24(4)10-12-25/h5-8,15H,9-13H2,1-4H3,(H,20,21,23)/t15-/m1/s1 |
| InChIKey | XNNIAQWGYMYSCT-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine?
The IUPAC name of 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine (CID 95509786) is 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine.
What is the SMILES notation for 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine?
The canonical SMILES for 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine is Cc1ccc(-c2ccnc(NC[C@@H](C)N3CCN(C)CC3)n2)c(C)n1.
What is the InChIKey of 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine?
The InChIKey is XNNIAQWGYMYSCT-OAHLLOKOSA-N. The full InChI is InChI=1S/C19H28N6/c1-14-5-6-17(16(3)22-14)18-7-8-20-19(23-18)21-13-15(2)25-11-9-24(4)10-12-25/h5-8,15H,9-13H2,1-4H3,(H,20,21,23)/t15-/m1/s1.
What are the key properties of 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine?
4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine has a molecular weight of 340.48 g/mol, XLogP of 2.20, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dimethyl-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)propyl]pyrimidin-2-amine is sourced from PubChem (CID 95509786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).