C12H16N6O2S — CID 95525342
(5S)-1,3-dimethyl-5-[(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]imidazolidine-2,4-dione (PubChem CID 95525342) has the molecular formula C12H16N6O2S and a molecular weight of 308.37 g/mol. Its IUPAC name is (5S)-1,3-dimethyl-5-[(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-1,3-dimethyl-5-[(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95525342 |
| Molecular Formula | C12H16N6O2S |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (5S)-1,3-dimethyl-5-[(3-propan-2-yl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC(C)c1nnc2sc(C[C@H]3C(=O)N(C)C(=O)N3C)nn12 |
| InChI | InChI=1S/C12H16N6O2S/c1-6(2)9-13-14-11-18(9)15-8(21-11)5-7-10(19)17(4)12(20)16(7)3/h6-7H,5H2,1-4H3/t7-/m0/s1 |
| InChIKey | KDLZZFOPVWOGDH-ZETCQYMHSA-N |
| XLogP | 0.74 |
| TPSA | 83.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|