C21H20F2N2O — CID 95532328
2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidine-1-carbonyl]benzonitrile (PubChem CID 95532328) has the molecular formula C21H20F2N2O and a molecular weight of 354.40 g/mol. Its IUPAC name is 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidine-1-carbonyl]benzonitrile.
| Compound Name | 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidine-1-carbonyl]benzonitrile |
|---|---|
| PubChem CID | 95532328 |
| Molecular Formula | C21H20F2N2O |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2-[(3R)-3-[2-(2,4-difluorophenyl)ethyl]piperidine-1-carbonyl]benzonitrile |
| SMILES | N#Cc1ccccc1C(=O)N1CCC[C@@H](CCc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C21H20F2N2O/c22-18-10-9-16(20(23)12-18)8-7-15-4-3-11-25(14-15)21(26)19-6-2-1-5-17(19)13-24/h1-2,5-6,9-10,12,15H,3-4,7-8,11,14H2/t15-/m0/s1 |
| InChIKey | GXCLPUDDHWPZCP-HNNXBMFYSA-N |
| XLogP | 4.32 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |