C23H29N3O2 — CID 95543076
(2R)-2-(6-methoxynaphthalen-2-yl)-4-[[3-(2-methylpropyl)imidazol-4-yl]methyl]morpholine (PubChem CID 95543076) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is (2R)-2-(6-methoxynaphthalen-2-yl)-4-[[3-(2-methylpropyl)imidazol-4-yl]methyl]morpholine.
| Compound Name | (2R)-2-(6-methoxynaphthalen-2-yl)-4-[[3-(2-methylpropyl)imidazol-4-yl]methyl]morpholine |
|---|---|
| PubChem CID | 95543076 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (2R)-2-(6-methoxynaphthalen-2-yl)-4-[[3-(2-methylpropyl)imidazol-4-yl]methyl]morpholine |
| SMILES | COc1ccc2cc([C@@H]3CN(Cc4cncn4CC(C)C)CCO3)ccc2c1 |
| InChI | InChI=1S/C23H29N3O2/c1-17(2)13-26-16-24-12-21(26)14-25-8-9-28-23(15-25)20-5-4-19-11-22(27-3)7-6-18(19)10-20/h4-7,10-12,16-17,23H,8-9,13-15H2,1-3H3/t23-/m0/s1 |
| InChIKey | GUWUKIMSJBNSEF-QHCPKHFHSA-N |
| XLogP | 4.27 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |