About 2-(4-fluorophenyl)-1,3-dihydroisoindole
2-(4-fluorophenyl)-1,3-dihydroisoindole (PubChem CID 955436) has the molecular formula C14H12FN
and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(4-fluorophenyl)-1,3-dihydroisoindole |
| PubChem CID | 955436 |
| Molecular Formula | C14H12FN |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2-(4-fluorophenyl)-1,3-dihydroisoindole |
| SMILES | Fc1ccc(N2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C14H12FN/c15-13-5-7-14(8-6-13)16-9-11-3-1-2-4-12(11)10-16/h1-8H,9-10H2 |
| InChIKey | BXHFJLVANNYCTL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorophenyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenyl)-1,3-dihydroisoindole?
The IUPAC name of 2-(4-fluorophenyl)-1,3-dihydroisoindole (CID 955436) is 2-(4-fluorophenyl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(4-fluorophenyl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(4-fluorophenyl)-1,3-dihydroisoindole is Fc1ccc(N2Cc3ccccc3C2)cc1.
What is the InChIKey of 2-(4-fluorophenyl)-1,3-dihydroisoindole?
The InChIKey is BXHFJLVANNYCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12FN/c15-13-5-7-14(8-6-13)16-9-11-3-1-2-4-12(11)10-16/h1-8H,9-10H2.
What are the key properties of 2-(4-fluorophenyl)-1,3-dihydroisoindole?
2-(4-fluorophenyl)-1,3-dihydroisoindole has a molecular weight of 213.26 g/mol, XLogP of 3.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenyl)-1,3-dihydroisoindole is sourced from PubChem (CID 955436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).