C21H26N6 — CID 95549265
(4R)-4-cyclopropyl-5-[[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine (PubChem CID 95549265) has the molecular formula C21H26N6 and a molecular weight of 362.48 g/mol. Its IUPAC name is (4R)-4-cyclopropyl-5-[[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine.
| Compound Name | (4R)-4-cyclopropyl-5-[[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 95549265 |
| Molecular Formula | C21H26N6 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.22 |
| IUPAC Name | (4R)-4-cyclopropyl-5-[[2,4-dimethyl-5-(1,2,4-triazol-1-ylmethyl)phenyl]methyl]-1,4,6,7-tetrahydroimidazo[4,5-c]pyridine |
| SMILES | Cc1cc(C)c(Cn2cncn2)cc1CN1CCc2[nH]cnc2[C@H]1C1CC1 |
| InChI | InChI=1S/C21H26N6/c1-14-7-15(2)18(10-27-13-22-11-25-27)8-17(14)9-26-6-5-19-20(24-12-23-19)21(26)16-3-4-16/h7-8,11-13,16,21H,3-6,9-10H2,1-2H3,(H,23,24)/t21-/m1/s1 |
| InChIKey | ZZHCQQPSFVIZMN-OAQYLSRUSA-N |
| XLogP | 3.18 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |