C20H21F3N2O2 — CID 95550119
5-[(3R)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one (PubChem CID 95550119) has the molecular formula C20H21F3N2O2 and a molecular weight of 378.39 g/mol. Its IUPAC name is 5-[(3R)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one.
| Compound Name | 5-[(3R)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 95550119 |
| Molecular Formula | C20H21F3N2O2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 5-[(3R)-3-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidine-1-carbonyl]-1H-pyridin-2-one |
| SMILES | O=C(c1ccc(=O)[nH]c1)N1CCC[C@@H](CCc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C20H21F3N2O2/c21-20(22,23)17-5-1-3-14(11-17)6-7-15-4-2-10-25(13-15)19(27)16-8-9-18(26)24-12-16/h1,3,5,8-9,11-12,15H,2,4,6-7,10,13H2,(H,24,26)/t15-/m0/s1 |
| InChIKey | YLZUAEDOMZHSCL-HNNXBMFYSA-N |
| XLogP | 3.88 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |