About 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine
4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine (PubChem CID 95550593) has the molecular formula C14H21N3O2
and a molecular weight of 263.34 g/mol. Its IUPAC name is 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine |
| PubChem CID | 95550593 |
| Molecular Formula | C14H21N3O2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(C2CCC2)nc(NC[C@H]2COCCO2)n1 |
| InChI | InChI=1S/C14H21N3O2/c1-10-7-13(11-3-2-4-11)17-14(16-10)15-8-12-9-18-5-6-19-12/h7,11-12H,2-6,8-9H2,1H3,(H,15,16,17)/t12-/m0/s1 |
| InChIKey | WMMZXGKWLITHJZ-LBPRGKRZSA-N |
| XLogP | 1.88 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine?
The IUPAC name of 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine (CID 95550593) is 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine.
What is the SMILES notation for 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine?
The canonical SMILES for 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine is Cc1cc(C2CCC2)nc(NC[C@H]2COCCO2)n1.
What is the InChIKey of 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine?
The InChIKey is WMMZXGKWLITHJZ-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H21N3O2/c1-10-7-13(11-3-2-4-11)17-14(16-10)15-8-12-9-18-5-6-19-12/h7,11-12H,2-6,8-9H2,1H3,(H,15,16,17)/t12-/m0/s1.
What are the key properties of 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine?
4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine has a molecular weight of 263.34 g/mol, XLogP of 1.88, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclobutyl-N-[[(2S)-1,4-dioxan-2-yl]methyl]-6-methylpyrimidin-2-amine is sourced from PubChem (CID 95550593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).