About (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine
(2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine (PubChem CID 95551152) has the molecular formula C11H14F3N3O2
and a molecular weight of 277.25 g/mol. Its IUPAC name is (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine.
Molecular Properties
| Compound Name | (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine |
| PubChem CID | 95551152 |
| Molecular Formula | C11H14F3N3O2 |
| Molecular Weight | 277.25 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)[C@@H]1CN(Cc2nnc(C3CC3)o2)CCO1 |
| InChI | InChI=1S/C11H14F3N3O2/c12-11(13,14)8-5-17(3-4-18-8)6-9-15-16-10(19-9)7-1-2-7/h7-8H,1-6H2/t8-/m0/s1 |
| InChIKey | PPZOHNJPFXUJGU-QMMMGPOBSA-N |
| XLogP | 1.71 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine?
The IUPAC name of (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine (CID 95551152) is (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine.
What is the SMILES notation for (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine?
The canonical SMILES for (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine is FC(F)(F)[C@@H]1CN(Cc2nnc(C3CC3)o2)CCO1.
What is the InChIKey of (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine?
The InChIKey is PPZOHNJPFXUJGU-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H14F3N3O2/c12-11(13,14)8-5-17(3-4-18-8)6-9-15-16-10(19-9)7-1-2-7/h7-8H,1-6H2/t8-/m0/s1.
What are the key properties of (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine?
(2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine has a molecular weight of 277.25 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-2-(trifluoromethyl)morpholine is sourced from PubChem (CID 95551152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).