C20H21N3O2 — CID 95551290
N-[(R)-cyclopropyl-(4-methyl-2-pyridinyl)methyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide (PubChem CID 95551290) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-[(R)-cyclopropyl-(4-methyl-2-pyridinyl)methyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide.
| Compound Name | N-[(R)-cyclopropyl-(4-methyl-2-pyridinyl)methyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 95551290 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | N-[(R)-cyclopropyl-(4-methyl-2-pyridinyl)methyl]-2-(2,3-dihydroindol-1-yl)-2-oxoacetamide |
| SMILES | Cc1ccnc([C@H](NC(=O)C(=O)N2CCc3ccccc32)C2CC2)c1 |
| InChI | InChI=1S/C20H21N3O2/c1-13-8-10-21-16(12-13)18(15-6-7-15)22-19(24)20(25)23-11-9-14-4-2-3-5-17(14)23/h2-5,8,10,12,15,18H,6-7,9,11H2,1H3,(H,22,24)/t18-/m1/s1 |
| InChIKey | XEMHWSIRAJDZHG-GOSISDBHSA-N |
| XLogP | 2.55 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|