C17H19FN4O2 — CID 95551628
(3S)-1-(6-aminopyrimidin-4-yl)-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylic acid (PubChem CID 95551628) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is (3S)-1-(6-aminopyrimidin-4-yl)-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylic acid.
| Compound Name | (3S)-1-(6-aminopyrimidin-4-yl)-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 95551628 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (3S)-1-(6-aminopyrimidin-4-yl)-3-[(2-fluorophenyl)methyl]piperidine-3-carboxylic acid |
| SMILES | Nc1cc(N2CCC[C@@](Cc3ccccc3F)(C(=O)O)C2)ncn1 |
| InChI | InChI=1S/C17H19FN4O2/c18-13-5-2-1-4-12(13)9-17(16(23)24)6-3-7-22(10-17)15-8-14(19)20-11-21-15/h1-2,4-5,8,11H,3,6-7,9-10H2,(H,23,24)(H2,19,20,21)/t17-/m0/s1 |
| InChIKey | SGFDZUGCAZECNG-KRWDZBQOSA-N |
| XLogP | 2.11 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |