C19H27FN2O2 — CID 95551947
1-[(3S)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-1-yl]butane-1,2-dione (PubChem CID 95551947) has the molecular formula C19H27FN2O2 and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(3S)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-1-yl]butane-1,2-dione.
| Compound Name | 1-[(3S)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-1-yl]butane-1,2-dione |
|---|---|
| PubChem CID | 95551947 |
| Molecular Formula | C19H27FN2O2 |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 1-[(3S)-4-[(4-fluorophenyl)methyl]-3-propan-2-yl-1,4-diazepan-1-yl]butane-1,2-dione |
| SMILES | CCC(=O)C(=O)N1CCCN(Cc2ccc(F)cc2)[C@@H](C(C)C)C1 |
| InChI | InChI=1S/C19H27FN2O2/c1-4-18(23)19(24)22-11-5-10-21(17(13-22)14(2)3)12-15-6-8-16(20)9-7-15/h6-9,14,17H,4-5,10-13H2,1-3H3/t17-/m1/s1 |
| InChIKey | FWNSVWAJGZZEQN-QGZVFWFLSA-N |
| XLogP | 2.86 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|