C22H22N4O2 — CID 95552211
[(3S)-1-[6-(2-methoxyphenyl)pyridazin-3-yl]piperidin-3-yl]-pyridin-2-ylmethanone (PubChem CID 95552211) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is [(3S)-1-[6-(2-methoxyphenyl)pyridazin-3-yl]piperidin-3-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3S)-1-[6-(2-methoxyphenyl)pyridazin-3-yl]piperidin-3-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 95552211 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | [(3S)-1-[6-(2-methoxyphenyl)pyridazin-3-yl]piperidin-3-yl]-pyridin-2-ylmethanone |
| SMILES | COc1ccccc1-c1ccc(N2CCC[C@H](C(=O)c3ccccn3)C2)nn1 |
| InChI | InChI=1S/C22H22N4O2/c1-28-20-10-3-2-8-17(20)18-11-12-21(25-24-18)26-14-6-7-16(15-26)22(27)19-9-4-5-13-23-19/h2-5,8-13,16H,6-7,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | NEKOJQKQSXJOSH-INIZCTEOSA-N |
| XLogP | 3.65 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |