C20H28N2O3 — CID 95552384
[(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[(3R)-2-ethyl-3,4-dihydro-1H-isoquinolin-3-yl]methanone (PubChem CID 95552384) has the molecular formula C20H28N2O3 and a molecular weight of 344.46 g/mol. Its IUPAC name is [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[(3R)-2-ethyl-3,4-dihydro-1H-isoquinolin-3-yl]methanone.
| Compound Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[(3R)-2-ethyl-3,4-dihydro-1H-isoquinolin-3-yl]methanone |
|---|---|
| PubChem CID | 95552384 |
| Molecular Formula | C20H28N2O3 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.21 |
| IUPAC Name | [(3aS,5S,6S,7aR)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]-[(3R)-2-ethyl-3,4-dihydro-1H-isoquinolin-3-yl]methanone |
| SMILES | CCN1Cc2ccccc2C[C@@H]1C(=O)N1C[C@H]2C[C@H](O)[C@@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H28N2O3/c1-2-21-10-14-6-4-3-5-13(14)7-17(21)20(25)22-11-15-8-18(23)19(24)9-16(15)12-22/h3-6,15-19,23-24H,2,7-12H2,1H3/t15-,16+,17-,18+,19+/m1/s1 |
| InChIKey | UZGZTCRTFOGQBO-LFDJNIOPSA-N |
| XLogP | 1.02 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |