About (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine
(2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine (PubChem CID 95555777) has the molecular formula C14H13F3N2OS
and a molecular weight of 314.33 g/mol. Its IUPAC name is (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine.
Molecular Properties
| Compound Name | (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine |
| PubChem CID | 95555777 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine |
| SMILES | FC(F)(F)[C@H]1CN(c2nc(-c3ccccc3)cs2)CCO1 |
| InChI | InChI=1S/C14H13F3N2OS/c15-14(16,17)12-8-19(6-7-20-12)13-18-11(9-21-13)10-4-2-1-3-5-10/h1-5,9,12H,6-8H2/t12-/m1/s1 |
| InChIKey | LXOUZHWJHZGPIT-GFCCVEGCSA-N |
| XLogP | 3.58 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine?
The IUPAC name of (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine (CID 95555777) is (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine.
What is the SMILES notation for (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine?
The canonical SMILES for (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine is FC(F)(F)[C@H]1CN(c2nc(-c3ccccc3)cs2)CCO1.
What is the InChIKey of (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine?
The InChIKey is LXOUZHWJHZGPIT-GFCCVEGCSA-N. The full InChI is InChI=1S/C14H13F3N2OS/c15-14(16,17)12-8-19(6-7-20-12)13-18-11(9-21-13)10-4-2-1-3-5-10/h1-5,9,12H,6-8H2/t12-/m1/s1.
What are the key properties of (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine?
(2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine has a molecular weight of 314.33 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(4-phenyl-1,3-thiazol-2-yl)-2-(trifluoromethyl)morpholine is sourced from PubChem (CID 95555777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).