C22H25N3O — CID 95557695
(2S)-2-(2-phenylethyl)-4-[(2-pyrazol-1-ylphenyl)methyl]morpholine (PubChem CID 95557695) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is (2S)-2-(2-phenylethyl)-4-[(2-pyrazol-1-ylphenyl)methyl]morpholine.
| Compound Name | (2S)-2-(2-phenylethyl)-4-[(2-pyrazol-1-ylphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 95557695 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | (2S)-2-(2-phenylethyl)-4-[(2-pyrazol-1-ylphenyl)methyl]morpholine |
| SMILES | c1ccc(CC[C@H]2CN(Cc3ccccc3-n3cccn3)CCO2)cc1 |
| InChI | InChI=1S/C22H25N3O/c1-2-7-19(8-3-1)11-12-21-18-24(15-16-26-21)17-20-9-4-5-10-22(20)25-14-6-13-23-25/h1-10,13-14,21H,11-12,15-18H2/t21-/m0/s1 |
| InChIKey | WIFMYZHFSDQBMD-NRFANRHFSA-N |
| XLogP | 3.71 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |