C17H25N3O — CID 95557957
1-[(2S)-butan-2-yl]-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]urea (PubChem CID 95557957) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 1-[(2S)-butan-2-yl]-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]urea.
| Compound Name | 1-[(2S)-butan-2-yl]-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]urea |
|---|---|
| PubChem CID | 95557957 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 1-[(2S)-butan-2-yl]-3-[(2,3,5-trimethyl-1H-indol-7-yl)methyl]urea |
| SMILES | CC[C@H](C)NC(=O)NCc1cc(C)cc2c(C)c(C)[nH]c12 |
| InChI | InChI=1S/C17H25N3O/c1-6-11(3)19-17(21)18-9-14-7-10(2)8-15-12(4)13(5)20-16(14)15/h7-8,11,20H,6,9H2,1-5H3,(H2,18,19,21)/t11-/m0/s1 |
| InChIKey | AXINONGOGLHRBU-NSHDSACASA-N |
| XLogP | 3.69 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|