C22H21NO — CID 95559383
(1R)-1-[(S)-phenyl(pyridin-2-yl)methyl]-3,4-dihydro-2H-naphthalen-1-ol (PubChem CID 95559383) has the molecular formula C22H21NO and a molecular weight of 315.42 g/mol. Its IUPAC name is (1R)-1-[(S)-phenyl(pyridin-2-yl)methyl]-3,4-dihydro-2H-naphthalen-1-ol.
| Compound Name | (1R)-1-[(S)-phenyl(pyridin-2-yl)methyl]-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 95559383 |
| Molecular Formula | C22H21NO |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | (1R)-1-[(S)-phenyl(pyridin-2-yl)methyl]-3,4-dihydro-2H-naphthalen-1-ol |
| SMILES | O[C@@]1([C@@H](c2ccccc2)c2ccccn2)CCCc2ccccc21 |
| InChI | InChI=1S/C22H21NO/c24-22(15-8-12-17-9-4-5-13-19(17)22)21(18-10-2-1-3-11-18)20-14-6-7-16-23-20/h1-7,9-11,13-14,16,21,24H,8,12,15H2/t21-,22-/m0/s1 |
| InChIKey | CJPSKHSJOBNTAC-VXKWHMMOSA-N |
| XLogP | 4.44 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |