About 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid
3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid (PubChem CID 95559502) has the molecular formula C13H10ClNO6
and a molecular weight of 311.68 g/mol. Its IUPAC name is 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid |
| PubChem CID | 95559502 |
| Molecular Formula | C13H10ClNO6 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid |
| SMILES | O=C(O)CCc1c(C(=O)O)[nH]c2c(Cl)ccc(C(=O)O)c12 |
| InChI | InChI=1S/C13H10ClNO6/c14-7-3-1-6(12(18)19)9-5(2-4-8(16)17)10(13(20)21)15-11(7)9/h1,3,15H,2,4H2,(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | DUPUNPXFUDMXCB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid?
The IUPAC name of 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid (CID 95559502) is 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid.
What is the SMILES notation for 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid?
The canonical SMILES for 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid is O=C(O)CCc1c(C(=O)O)[nH]c2c(Cl)ccc(C(=O)O)c12.
What is the InChIKey of 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid?
The InChIKey is DUPUNPXFUDMXCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClNO6/c14-7-3-1-6(12(18)19)9-5(2-4-8(16)17)10(13(20)21)15-11(7)9/h1,3,15H,2,4H2,(H,16,17)(H,18,19)(H,20,21).
What are the key properties of 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid?
3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid has a molecular weight of 311.68 g/mol, XLogP of 2.23, 5 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-carboxyethyl)-7-chloro-1H-indole-2,4-dicarboxylic acid is sourced from PubChem (CID 95559502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).